C45H39N3O4S — CID 145264451
[(Z)-[[4-(N-[3-[(Z)-N-acetyloxy-C-phenylcarbonimidoyl]-6-cyclopentylsulfanylnaphthalen-1-yl]anilino)phenyl]-phenylmethylidene]amino] acetate (PubChem CID 145264451) has the molecular formula C45H39N3O4S and a molecular weight of 717.89 g/mol. Its IUPAC name is [(Z)-[[4-(N-[3-[(Z)-N-acetyloxy-C-phenylcarbonimidoyl]-6-cyclopentylsulfanylnaphthalen-1-yl]anilino)phenyl]-phenylmethylidene]amino] acetate.
| Compound Name | [(Z)-[[4-(N-[3-[(Z)-N-acetyloxy-C-phenylcarbonimidoyl]-6-cyclopentylsulfanylnaphthalen-1-yl]anilino)phenyl]-phenylmethylidene]amino] acetate |
|---|---|
| PubChem CID | 145264451 |
| Molecular Formula | C45H39N3O4S |
| Molecular Weight | 717.89 g/mol |
| Exact Mass | 717.27 |
| IUPAC Name | [(Z)-[[4-(N-[3-[(Z)-N-acetyloxy-C-phenylcarbonimidoyl]-6-cyclopentylsulfanylnaphthalen-1-yl]anilino)phenyl]-phenylmethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(/c1ccccc1)c1ccc(N(c2ccccc2)c2cc(/C(=N\OC(C)=O)c3ccccc3)cc3cc(SC4CCCC4)ccc23)cc1 |
| InChI | InChI=1S/C45H39N3O4S/c1-31(49)51-46-44(33-14-6-3-7-15-33)35-22-24-39(25-23-35)48(38-18-10-5-11-19-38)43-30-37(45(47-52-32(2)50)34-16-8-4-9-17-34)28-36-29-41(26-27-42(36)43)53-40-20-12-13-21-40/h3-11,14-19,22-30,40H,12-13,20-21H2,1-2H3/b46-44-,47-45- |
| InChIKey | ZUZGQSDKNRKMJL-JWWXKWLGSA-N |
| XLogP | 10.98 |
| TPSA | 80.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.89 |
| LogP ≤ 5 | 10.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|