C34H36N4O4 — CID 145264488
[(Z)-1-[4-[4-[(Z)-N-acetyloxy-C-methylcarbonimidoyl]-N-[6-(diethylamino)naphthalen-1-yl]anilino]phenyl]ethylideneamino] acetate (PubChem CID 145264488) has the molecular formula C34H36N4O4 and a molecular weight of 564.69 g/mol. Its IUPAC name is [(Z)-1-[4-[4-[(Z)-N-acetyloxy-C-methylcarbonimidoyl]-N-[6-(diethylamino)naphthalen-1-yl]anilino]phenyl]ethylideneamino] acetate.
| Compound Name | [(Z)-1-[4-[4-[(Z)-N-acetyloxy-C-methylcarbonimidoyl]-N-[6-(diethylamino)naphthalen-1-yl]anilino]phenyl]ethylideneamino] acetate |
|---|---|
| PubChem CID | 145264488 |
| Molecular Formula | C34H36N4O4 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.27 |
| IUPAC Name | [(Z)-1-[4-[4-[(Z)-N-acetyloxy-C-methylcarbonimidoyl]-N-[6-(diethylamino)naphthalen-1-yl]anilino]phenyl]ethylideneamino] acetate |
| SMILES | CCN(CC)c1ccc2c(N(c3ccc(/C(C)=N\OC(C)=O)cc3)c3ccc(/C(C)=N\OC(C)=O)cc3)cccc2c1 |
| InChI | InChI=1S/C34H36N4O4/c1-7-37(8-2)32-20-21-33-29(22-32)10-9-11-34(33)38(30-16-12-27(13-17-30)23(3)35-41-25(5)39)31-18-14-28(15-19-31)24(4)36-42-26(6)40/h9-22H,7-8H2,1-6H3/b35-23-,36-24- |
| InChIKey | UVTUNIGTUDNZFN-RXCNPGAZSA-N |
| XLogP | 7.73 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|