C44H38N4O6 — CID 145264444
[(Z)-[[3-[4-[(Z)-N-acetyloxy-C-phenylcarbonimidoyl]-3-[2-hydroxyethyl(methyl)carbamoyl]-N-naphthalen-1-ylanilino]phenyl]-phenylmethylidene]amino] acetate (PubChem CID 145264444) has the molecular formula C44H38N4O6 and a molecular weight of 718.81 g/mol. Its IUPAC name is [(Z)-[[3-[4-[(Z)-N-acetyloxy-C-phenylcarbonimidoyl]-3-[2-hydroxyethyl(methyl)carbamoyl]-N-naphthalen-1-ylanilino]phenyl]-phenylmethylidene]amino] acetate.
| Compound Name | [(Z)-[[3-[4-[(Z)-N-acetyloxy-C-phenylcarbonimidoyl]-3-[2-hydroxyethyl(methyl)carbamoyl]-N-naphthalen-1-ylanilino]phenyl]-phenylmethylidene]amino] acetate |
|---|---|
| PubChem CID | 145264444 |
| Molecular Formula | C44H38N4O6 |
| Molecular Weight | 718.81 g/mol |
| Exact Mass | 718.28 |
| IUPAC Name | [(Z)-[[3-[4-[(Z)-N-acetyloxy-C-phenylcarbonimidoyl]-3-[2-hydroxyethyl(methyl)carbamoyl]-N-naphthalen-1-ylanilino]phenyl]-phenylmethylidene]amino] acetate |
| SMILES | CC(=O)O/N=C(/c1ccccc1)c1cccc(N(c2ccc(/C(=N\OC(C)=O)c3ccccc3)c(C(=O)N(C)CCO)c2)c2cccc3ccccc23)c1 |
| InChI | InChI=1S/C44H38N4O6/c1-30(50)53-45-42(33-15-6-4-7-16-33)35-20-12-21-36(28-35)48(41-23-13-19-32-14-10-11-22-38(32)41)37-24-25-39(40(29-37)44(52)47(3)26-27-49)43(46-54-31(2)51)34-17-8-5-9-18-34/h4-25,28-29,49H,26-27H2,1-3H3/b45-42-,46-43- |
| InChIKey | AZZXOOZGZLSZOT-OBBHHDKFSA-N |
| XLogP | 8.00 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.81 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|