C19H21NO5 — CID 172922557
(4S,7aR,12bS)-5-hydroxy-7,9-dimethoxy-3-methyl-1,2,4,4a,5,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one (PubChem CID 172922557) has the molecular formula C19H21NO5 and a molecular weight of 343.38 g/mol. Its IUPAC name is (4S,7aR,12bS)-5-hydroxy-7,9-dimethoxy-3-methyl-1,2,4,4a,5,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one.
| Compound Name | (4S,7aR,12bS)-5-hydroxy-7,9-dimethoxy-3-methyl-1,2,4,4a,5,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one |
|---|---|
| PubChem CID | 172922557 |
| Molecular Formula | C19H21NO5 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (4S,7aR,12bS)-5-hydroxy-7,9-dimethoxy-3-methyl-1,2,4,4a,5,7a-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-13-one |
| SMILES | COC1=CC(O)C2[C@H]3C(=O)c4ccc(OC)c5c4[C@@]2(CCN3C)[C@H]1O5 |
| InChI | InChI=1S/C19H21NO5/c1-20-7-6-19-13-9-4-5-11(23-2)17(13)25-18(19)12(24-3)8-10(21)14(19)15(20)16(9)22/h4-5,8,10,14-15,18,21H,6-7H2,1-3H3/t10?,14?,15-,18-,19+/m0/s1 |
| InChIKey | YLFARCBNKWHHAD-ISOIWVPMSA-N |
| XLogP | 1.12 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |