C17H20N6O5 — CID 172923674
N'-hydroxy-4-methyl-3-nitrobenzenecarboximidamide;methanamine;4-methyl-3-nitrobenzonitrile (PubChem CID 172923674) has the molecular formula C17H20N6O5 and a molecular weight of 388.38 g/mol. Its IUPAC name is N'-hydroxy-4-methyl-3-nitrobenzenecarboximidamide;methanamine;4-methyl-3-nitrobenzonitrile.
| Compound Name | N'-hydroxy-4-methyl-3-nitrobenzenecarboximidamide;methanamine;4-methyl-3-nitrobenzonitrile |
|---|---|
| PubChem CID | 172923674 |
| Molecular Formula | C17H20N6O5 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | N'-hydroxy-4-methyl-3-nitrobenzenecarboximidamide;methanamine;4-methyl-3-nitrobenzonitrile |
| SMILES | CN.Cc1ccc(/C(N)=N/O)cc1[N+](=O)[O-].Cc1ccc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9N3O3.C8H6N2O2.CH5N/c1-5-2-3-6(8(9)10-12)4-7(5)11(13)14;1-6-2-3-7(5-9)4-8(6)10(11)12;1-2/h2-4,12H,1H3,(H2,9,10);2-4H,1H3;2H2,1H3 |
| InChIKey | NEPBKWDXBZNQMR-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 194.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|