About N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile
N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile (PubChem CID 158939002) has the molecular formula C16H15N5O5
and a molecular weight of 357.33 g/mol. Its IUPAC name is N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile.
Molecular Properties
| Compound Name | N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile |
| PubChem CID | 158939002 |
| Molecular Formula | C16H15N5O5 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile |
| SMILES | Cc1cc(C#N)ccc1[N+](=O)[O-].Cc1cc(C(N)=NO)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9N3O3.C8H6N2O2/c1-5-4-6(8(9)10-12)2-3-7(5)11(13)14;1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4,12H,1H3,(H2,9,10);2-4H,1H3 |
| InChIKey | JJZZQFJXIMEZNS-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 168.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile?
The IUPAC name of N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile (CID 158939002) is N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile.
What is the SMILES notation for N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile?
The canonical SMILES for N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile is Cc1cc(C#N)ccc1[N+](=O)[O-].Cc1cc(C(N)=NO)ccc1[N+](=O)[O-].
What is the InChIKey of N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile?
The InChIKey is JJZZQFJXIMEZNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O3.C8H6N2O2/c1-5-4-6(8(9)10-12)2-3-7(5)11(13)14;1-6-4-7(5-9)2-3-8(6)10(11)12/h2-4,12H,1H3,(H2,9,10);2-4H,1H3.
What are the key properties of N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile?
N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile has a molecular weight of 357.33 g/mol, XLogP of 2.77, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-3-methyl-4-nitrobenzenecarboximidamide;3-methyl-4-nitrobenzonitrile is sourced from PubChem (CID 158939002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).