C18H15N3O6S — CID 172926879
ethyl 5-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-1-benzofuran-2-carboxylate (PubChem CID 172926879) has the molecular formula C18H15N3O6S and a molecular weight of 401.40 g/mol. Its IUPAC name is ethyl 5-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-1-benzofuran-2-carboxylate.
| Compound Name | ethyl 5-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 172926879 |
| Molecular Formula | C18H15N3O6S |
| Molecular Weight | 401.40 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | ethyl 5-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-1-benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(C=N/N=C3/NC(=O)/C(=C\C(=O)OC)S3)ccc2o1 |
| InChI | InChI=1S/C18H15N3O6S/c1-3-26-17(24)13-7-11-6-10(4-5-12(11)27-13)9-19-21-18-20-16(23)14(28-18)8-15(22)25-2/h4-9H,3H2,1-2H3,(H,20,21,23)/b14-8+,19-9? |
| InChIKey | KTTHGYSUGQTOGK-RPAQRIPZSA-N |
| XLogP | 2.22 |
| TPSA | 119.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|