C18H16N4O5S2 — CID 172927057
ethyl 3-amino-5-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-1-benzothiophene-2-carboxylate (PubChem CID 172927057) has the molecular formula C18H16N4O5S2 and a molecular weight of 432.48 g/mol. Its IUPAC name is ethyl 3-amino-5-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-1-benzothiophene-2-carboxylate.
| Compound Name | ethyl 3-amino-5-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 172927057 |
| Molecular Formula | C18H16N4O5S2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | ethyl 3-amino-5-[[(Z)-[(5E)-5-(2-methoxy-2-oxoethylidene)-4-oxo-1,3-thiazolidin-2-ylidene]hydrazinylidene]methyl]-1-benzothiophene-2-carboxylate |
| SMILES | CCOC(=O)c1sc2ccc(C=N/N=C3/NC(=O)/C(=C\C(=O)OC)S3)cc2c1N |
| InChI | InChI=1S/C18H16N4O5S2/c1-3-27-17(25)15-14(19)10-6-9(4-5-11(10)28-15)8-20-22-18-21-16(24)12(29-18)7-13(23)26-2/h4-8H,3,19H2,1-2H3,(H,21,22,24)/b12-7+,20-8? |
| InChIKey | WVVMDHRNYOSSTH-PCNMSKDTSA-N |
| XLogP | 2.27 |
| TPSA | 132.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|