C23H27ClN2O3 — CID 172927360
(2R)-5-(4-chlorophenyl)-N'-(2-hydroxyethoxy)-4-oxo-2-[(4-prop-1-en-2-ylphenyl)methyl]pentanimidamide (PubChem CID 172927360) has the molecular formula C23H27ClN2O3 and a molecular weight of 414.93 g/mol. Its IUPAC name is (2R)-5-(4-chlorophenyl)-N'-(2-hydroxyethoxy)-4-oxo-2-[(4-prop-1-en-2-ylphenyl)methyl]pentanimidamide.
| Compound Name | (2R)-5-(4-chlorophenyl)-N'-(2-hydroxyethoxy)-4-oxo-2-[(4-prop-1-en-2-ylphenyl)methyl]pentanimidamide |
|---|---|
| PubChem CID | 172927360 |
| Molecular Formula | C23H27ClN2O3 |
| Molecular Weight | 414.93 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | (2R)-5-(4-chlorophenyl)-N'-(2-hydroxyethoxy)-4-oxo-2-[(4-prop-1-en-2-ylphenyl)methyl]pentanimidamide |
| SMILES | C=C(C)c1ccc(C[C@H](CC(=O)Cc2ccc(Cl)cc2)/C(N)=N/OCCO)cc1 |
| InChI | InChI=1S/C23H27ClN2O3/c1-16(2)19-7-3-17(4-8-19)13-20(23(25)26-29-12-11-27)15-22(28)14-18-5-9-21(24)10-6-18/h3-10,20,27H,1,11-15H2,2H3,(H2,25,26)/t20-/m1/s1 |
| InChIKey | WBOFTZOGRRDDQN-HXUWFJFHSA-N |
| XLogP | 4.01 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.93 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|