C15H20ClFN2O2 — CID 172927384
N-[(Z)-C-(2-chloro-6-fluorophenyl)-N-(cyclopropylmethoxy)carbonimidoyl]acetamide;ethane (PubChem CID 172927384) has the molecular formula C15H20ClFN2O2 and a molecular weight of 314.79 g/mol. Its IUPAC name is N-[(Z)-C-(2-chloro-6-fluorophenyl)-N-(cyclopropylmethoxy)carbonimidoyl]acetamide;ethane.
| Compound Name | N-[(Z)-C-(2-chloro-6-fluorophenyl)-N-(cyclopropylmethoxy)carbonimidoyl]acetamide;ethane |
|---|---|
| PubChem CID | 172927384 |
| Molecular Formula | C15H20ClFN2O2 |
| Molecular Weight | 314.79 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | N-[(Z)-C-(2-chloro-6-fluorophenyl)-N-(cyclopropylmethoxy)carbonimidoyl]acetamide;ethane |
| SMILES | CC.CC(=O)N/C(=N\OCC1CC1)c1c(F)cccc1Cl |
| InChI | InChI=1S/C13H14ClFN2O2.C2H6/c1-8(18)16-13(17-19-7-9-5-6-9)12-10(14)3-2-4-11(12)15;1-2/h2-4,9H,5-7H2,1H3,(H,16,17,18);1-2H3 |
| InChIKey | VSVSNCYZPPFKIV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|