C19H17F2N3O3 — CID 25171731
N-[[4-[(E)-cyclopropylmethoxyiminomethyl]phenyl]carbamoyl]-2,6-difluorobenzamide (PubChem CID 25171731) has the molecular formula C19H17F2N3O3 and a molecular weight of 373.36 g/mol. Its IUPAC name is N-[[4-[(E)-cyclopropylmethoxyiminomethyl]phenyl]carbamoyl]-2,6-difluorobenzamide.
| Compound Name | N-[[4-[(E)-cyclopropylmethoxyiminomethyl]phenyl]carbamoyl]-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 25171731 |
| Molecular Formula | C19H17F2N3O3 |
| Molecular Weight | 373.36 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[[4-[(E)-cyclopropylmethoxyiminomethyl]phenyl]carbamoyl]-2,6-difluorobenzamide |
| SMILES | O=C(NC(=O)c1c(F)cccc1F)Nc1ccc(/C=N/OCC2CC2)cc1 |
| InChI | InChI=1S/C19H17F2N3O3/c20-15-2-1-3-16(21)17(15)18(25)24-19(26)23-14-8-6-12(7-9-14)10-22-27-11-13-4-5-13/h1-3,6-10,13H,4-5,11H2,(H2,23,24,25,26)/b22-10+ |
| InChIKey | RYMKGACMWHNCJE-LSHDLFTRSA-N |
| XLogP | 3.69 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|