C20H21F2N3O3 — CID 25171523
2,6-difluoro-N-[[4-[(E)-pentoxyiminomethyl]phenyl]carbamoyl]benzamide (PubChem CID 25171523) has the molecular formula C20H21F2N3O3 and a molecular weight of 389.40 g/mol. Its IUPAC name is 2,6-difluoro-N-[[4-[(E)-pentoxyiminomethyl]phenyl]carbamoyl]benzamide.
| Compound Name | 2,6-difluoro-N-[[4-[(E)-pentoxyiminomethyl]phenyl]carbamoyl]benzamide |
|---|---|
| PubChem CID | 25171523 |
| Molecular Formula | C20H21F2N3O3 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | 2,6-difluoro-N-[[4-[(E)-pentoxyiminomethyl]phenyl]carbamoyl]benzamide |
| SMILES | CCCCCO/N=C/c1ccc(NC(=O)NC(=O)c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C20H21F2N3O3/c1-2-3-4-12-28-23-13-14-8-10-15(11-9-14)24-20(27)25-19(26)18-16(21)6-5-7-17(18)22/h5-11,13H,2-4,12H2,1H3,(H2,24,25,26,27)/b23-13+ |
| InChIKey | GDJKYBMDCXIFHA-YDZHTSKRSA-N |
| XLogP | 4.47 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|