About 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine
1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine (PubChem CID 172929077) has the molecular formula C16H27NO4S
and a molecular weight of 329.46 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine.
Molecular Properties
| Compound Name | 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine |
| PubChem CID | 172929077 |
| Molecular Formula | C16H27NO4S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine |
| SMILES | C.CC(C)/C=N/O.CC(C)C(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O3S.C4H9NO.CH4/c1-9(2)11(12)8-15(13,14)10-6-4-3-5-7-10;1-4(2)3-5-6;/h3-7,9H,8H2,1-2H3;3-4,6H,1-2H3;1H4/b;5-3+; |
| InChIKey | SCBQZRKRUKYOOR-PTDWBMLLSA-N |
| XLogP | 3.42 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine?
The IUPAC name of 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine (CID 172929077) is 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine.
What is the SMILES notation for 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine?
The canonical SMILES for 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine is C.CC(C)/C=N/O.CC(C)C(=O)CS(=O)(=O)c1ccccc1.
What is the InChIKey of 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine?
The InChIKey is SCBQZRKRUKYOOR-PTDWBMLLSA-N. The full InChI is InChI=1S/C11H14O3S.C4H9NO.CH4/c1-9(2)11(12)8-15(13,14)10-6-4-3-5-7-10;1-4(2)3-5-6;/h3-7,9H,8H2,1-2H3;3-4,6H,1-2H3;1H4/b;5-3+;.
What are the key properties of 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine?
1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine has a molecular weight of 329.46 g/mol, XLogP of 3.42, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine is sourced from PubChem (CID 172929077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).