C16H27NO4S — CID 172929077
1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine (PubChem CID 172929077) has the molecular formula C16H27NO4S and a molecular weight of 329.46 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine.
| Compound Name | 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine |
|---|---|
| PubChem CID | 172929077 |
| Molecular Formula | C16H27NO4S |
| Molecular Weight | 329.46 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 1-(benzenesulfonyl)-3-methylbutan-2-one;methane;(NE)-N-(2-methylpropylidene)hydroxylamine |
| SMILES | C.CC(C)/C=N/O.CC(C)C(=O)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C11H14O3S.C4H9NO.CH4/c1-9(2)11(12)8-15(13,14)10-6-4-3-5-7-10;1-4(2)3-5-6;/h3-7,9H,8H2,1-2H3;3-4,6H,1-2H3;1H4/b;5-3+; |
| InChIKey | SCBQZRKRUKYOOR-PTDWBMLLSA-N |
| XLogP | 3.42 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|