C22H26N2O8S2 — CID 160935394
N-(2-hydroxyiminoethylidene)hydroxylamine;4-methyl-5,5-bis-(4-methylphenyl)sulfonylpentane-2,3-dione (PubChem CID 160935394) has the molecular formula C22H26N2O8S2 and a molecular weight of 510.59 g/mol. Its IUPAC name is N-(2-hydroxyiminoethylidene)hydroxylamine;4-methyl-5,5-bis-(4-methylphenyl)sulfonylpentane-2,3-dione.
| Compound Name | N-(2-hydroxyiminoethylidene)hydroxylamine;4-methyl-5,5-bis-(4-methylphenyl)sulfonylpentane-2,3-dione |
|---|---|
| PubChem CID | 160935394 |
| Molecular Formula | C22H26N2O8S2 |
| Molecular Weight | 510.59 g/mol |
| Exact Mass | 510.11 |
| IUPAC Name | N-(2-hydroxyiminoethylidene)hydroxylamine;4-methyl-5,5-bis-(4-methylphenyl)sulfonylpentane-2,3-dione |
| SMILES | CC(=O)C(=O)C(C)C(S(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1.ON=CC=NO |
| InChI | InChI=1S/C20H22O6S2.C2H4N2O2/c1-13-5-9-17(10-6-13)27(23,24)20(15(3)19(22)16(4)21)28(25,26)18-11-7-14(2)8-12-18;5-3-1-2-4-6/h5-12,15,20H,1-4H3;1-2,5-6H |
| InChIKey | STURNPFYTDRVRQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 167.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.59 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|