C22H32N4O11S2 — CID 172929891
2-methoxyethyl 3-[(2S,3S)-3-[(3E)-3-(2-amino-1,3-thiazol-4-yl)-3-(2-formyloxypropan-2-yloxyimino)-2-oxopropyl]-2-methyl-4-oxoazetidin-1-yl]sulfonyloxy-2,2-dimethylpropanoate (PubChem CID 172929891) has the molecular formula C22H32N4O11S2 and a molecular weight of 592.65 g/mol. Its IUPAC name is 2-methoxyethyl 3-[(2S,3S)-3-[(3E)-3-(2-amino-1,3-thiazol-4-yl)-3-(2-formyloxypropan-2-yloxyimino)-2-oxopropyl]-2-methyl-4-oxoazetidin-1-yl]sulfonyloxy-2,2-dimethylpropanoate.
| Compound Name | 2-methoxyethyl 3-[(2S,3S)-3-[(3E)-3-(2-amino-1,3-thiazol-4-yl)-3-(2-formyloxypropan-2-yloxyimino)-2-oxopropyl]-2-methyl-4-oxoazetidin-1-yl]sulfonyloxy-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 172929891 |
| Molecular Formula | C22H32N4O11S2 |
| Molecular Weight | 592.65 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | 2-methoxyethyl 3-[(2S,3S)-3-[(3E)-3-(2-amino-1,3-thiazol-4-yl)-3-(2-formyloxypropan-2-yloxyimino)-2-oxopropyl]-2-methyl-4-oxoazetidin-1-yl]sulfonyloxy-2,2-dimethylpropanoate |
| SMILES | COCCOC(=O)C(C)(C)COS(=O)(=O)N1C(=O)[C@@H](CC(=O)/C(=N/OC(C)(C)OC=O)c2csc(N)n2)[C@@H]1C |
| InChI | InChI=1S/C22H32N4O11S2/c1-13-14(9-16(28)17(15-10-38-20(23)24-15)25-37-22(4,5)35-12-27)18(29)26(13)39(31,32)36-11-21(2,3)19(30)34-8-7-33-6/h10,12-14H,7-9,11H2,1-6H3,(H2,23,24)/b25-17+/t13-,14-/m0/s1 |
| InChIKey | WNOAIXAXKLIEME-UBDNFVMVSA-N |
| XLogP | 0.64 |
| TPSA | 203.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.65 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|