C24H37N5O10S2 — CID 138504026
2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-1-(3-hexoxy-2,2-dimethyl-3-oxopropoxy)sulfonyl-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid (PubChem CID 138504026) has the molecular formula C24H37N5O10S2 and a molecular weight of 619.72 g/mol. Its IUPAC name is 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-1-(3-hexoxy-2,2-dimethyl-3-oxopropoxy)sulfonyl-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid.
| Compound Name | 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-1-(3-hexoxy-2,2-dimethyl-3-oxopropoxy)sulfonyl-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 138504026 |
| Molecular Formula | C24H37N5O10S2 |
| Molecular Weight | 619.72 g/mol |
| Exact Mass | 619.20 |
| IUPAC Name | 2-[[1-(2-amino-1,3-thiazol-4-yl)-2-[[(2S,3S)-1-(3-hexoxy-2,2-dimethyl-3-oxopropoxy)sulfonyl-2-methyl-4-oxoazetidin-3-yl]amino]-2-oxoethylidene]amino]oxy-2-methylpropanoic acid |
| SMILES | CCCCCCOC(=O)C(C)(C)COS(=O)(=O)N1C(=O)[C@@H](NC(=O)C(=NOC(C)(C)C(=O)O)c2csc(N)n2)[C@@H]1C |
| InChI | InChI=1S/C24H37N5O10S2/c1-7-8-9-10-11-37-21(34)23(3,4)13-38-41(35,36)29-14(2)16(19(29)31)27-18(30)17(15-12-40-22(25)26-15)28-39-24(5,6)20(32)33/h12,14,16H,7-11,13H2,1-6H3,(H2,25,26)(H,27,30)(H,32,33)/t14-,16-/m0/s1 |
| InChIKey | HMNVALFJRGXIRG-HOCLYGCPSA-N |
| XLogP | 1.44 |
| TPSA | 216.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.72 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|