C18H40N2O — CID 172939419
N-tert-butyl-2,2-dimethylpropan-1-amine;(E)-2,2-dimethyl-N-[(2-methylpropan-2-yl)oxy]propan-1-imine (PubChem CID 172939419) has the molecular formula C18H40N2O and a molecular weight of 300.53 g/mol. Its IUPAC name is N-tert-butyl-2,2-dimethylpropan-1-amine;(E)-2,2-dimethyl-N-[(2-methylpropan-2-yl)oxy]propan-1-imine.
| Compound Name | N-tert-butyl-2,2-dimethylpropan-1-amine;(E)-2,2-dimethyl-N-[(2-methylpropan-2-yl)oxy]propan-1-imine |
|---|---|
| PubChem CID | 172939419 |
| Molecular Formula | C18H40N2O |
| Molecular Weight | 300.53 g/mol |
| Exact Mass | 300.31 |
| IUPAC Name | N-tert-butyl-2,2-dimethylpropan-1-amine;(E)-2,2-dimethyl-N-[(2-methylpropan-2-yl)oxy]propan-1-imine |
| SMILES | CC(C)(C)/C=N/OC(C)(C)C.CC(C)(C)CNC(C)(C)C |
| InChI | InChI=1S/C9H19NO.C9H21N/c1-8(2,3)7-10-11-9(4,5)6;1-8(2,3)7-10-9(4,5)6/h7H,1-6H3;10H,7H2,1-6H3/b10-7+; |
| InChIKey | DFOYMBXGRYFZQE-HCUGZAAXSA-N |
| XLogP | 5.25 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|