C23H28ClN3O3 — CID 172940786
[(Z)-[amino-[4-[[(1S,3R)-3-methylcyclopentyl]methyl]phenyl]methylidene]amino] 5-chloro-6-propan-2-yloxypyridine-3-carboxylate (PubChem CID 172940786) has the molecular formula C23H28ClN3O3 and a molecular weight of 429.95 g/mol. Its IUPAC name is [(Z)-[amino-[4-[[(1S,3R)-3-methylcyclopentyl]methyl]phenyl]methylidene]amino] 5-chloro-6-propan-2-yloxypyridine-3-carboxylate.
| Compound Name | [(Z)-[amino-[4-[[(1S,3R)-3-methylcyclopentyl]methyl]phenyl]methylidene]amino] 5-chloro-6-propan-2-yloxypyridine-3-carboxylate |
|---|---|
| PubChem CID | 172940786 |
| Molecular Formula | C23H28ClN3O3 |
| Molecular Weight | 429.95 g/mol |
| Exact Mass | 429.18 |
| IUPAC Name | [(Z)-[amino-[4-[[(1S,3R)-3-methylcyclopentyl]methyl]phenyl]methylidene]amino] 5-chloro-6-propan-2-yloxypyridine-3-carboxylate |
| SMILES | CC(C)Oc1ncc(C(=O)O/N=C(\N)c2ccc(C[C@H]3CC[C@@H](C)C3)cc2)cc1Cl |
| InChI | InChI=1S/C23H28ClN3O3/c1-14(2)29-22-20(24)12-19(13-26-22)23(28)30-27-21(25)18-8-6-16(7-9-18)11-17-5-4-15(3)10-17/h6-9,12-15,17H,4-5,10-11H2,1-3H3,(H2,25,27)/t15-,17+/m1/s1 |
| InChIKey | KFYAHFZCMJLAET-WBVHZDCISA-N |
| XLogP | 4.98 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.95 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|