About N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine
N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine (PubChem CID 172941167) has the molecular formula C18H24N2
and a molecular weight of 268.40 g/mol. Its IUPAC name is N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine.
Molecular Properties
| Compound Name | N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine |
| PubChem CID | 172941167 |
| Molecular Formula | C18H24N2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine |
| SMILES | CCc1ccc(CC)c2cc(/C(C)=N/N(C)C)ccc12 |
| InChI | InChI=1S/C18H24N2/c1-6-14-8-9-15(7-2)18-12-16(10-11-17(14)18)13(3)19-20(4)5/h8-12H,6-7H2,1-5H3/b19-13+ |
| InChIKey | WTHFASGZSHZCSO-CPNJWEJPSA-N |
| XLogP | 4.25 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine?
The IUPAC name of N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine (CID 172941167) is N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine.
What is the SMILES notation for N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine?
The canonical SMILES for N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine is CCc1ccc(CC)c2cc(/C(C)=N/N(C)C)ccc12.
What is the InChIKey of N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine?
The InChIKey is WTHFASGZSHZCSO-CPNJWEJPSA-N. The full InChI is InChI=1S/C18H24N2/c1-6-14-8-9-15(7-2)18-12-16(10-11-17(14)18)13(3)19-20(4)5/h8-12H,6-7H2,1-5H3/b19-13+.
What are the key properties of N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine?
N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine has a molecular weight of 268.40 g/mol, XLogP of 4.25, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]-N-methylmethanamine is sourced from PubChem (CID 172941167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).