C19H24N2 — CID 160652434
(Z)-N-[(Z)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]propan-2-imine (PubChem CID 160652434) has the molecular formula C19H24N2 and a molecular weight of 280.42 g/mol. Its IUPAC name is (Z)-N-[(Z)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]propan-2-imine.
| Compound Name | (Z)-N-[(Z)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]propan-2-imine |
|---|---|
| PubChem CID | 160652434 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.42 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | (Z)-N-[(Z)-1-(5,8-diethylnaphthalen-2-yl)ethylideneamino]propan-2-imine |
| SMILES | CCc1ccc(CC)c2cc(/C(C)=N\N=C(C)C)ccc12 |
| InChI | InChI=1S/C19H24N2/c1-6-15-8-9-16(7-2)19-12-17(10-11-18(15)19)14(5)21-20-13(3)4/h8-12H,6-7H2,1-5H3/b21-14- |
| InChIKey | CVXCVLZSAQEIJR-STZFKDTASA-N |
| XLogP | 5.17 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|