About N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine
N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine (PubChem CID 172941752) has the molecular formula C6H10F3N3
and a molecular weight of 181.16 g/mol. Its IUPAC name is N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine.
Molecular Properties
| Compound Name | N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine |
| PubChem CID | 172941752 |
| Molecular Formula | C6H10F3N3 |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.08 |
| IUPAC Name | N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine |
| SMILES | C=C(C)/C=N\N(N)CC(F)(F)F |
| InChI | InChI=1S/C6H10F3N3/c1-5(2)3-11-12(10)4-6(7,8)9/h3H,1,4,10H2,2H3/b11-3- |
| InChIKey | QOKUYQPIDDSCHZ-JYOAFUTRSA-N |
| XLogP | 1.29 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine?
The IUPAC name of N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine (CID 172941752) is N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine.
What is the SMILES notation for N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine?
The canonical SMILES for N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine is C=C(C)/C=N\N(N)CC(F)(F)F.
What is the InChIKey of N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine?
The InChIKey is QOKUYQPIDDSCHZ-JYOAFUTRSA-N. The full InChI is InChI=1S/C6H10F3N3/c1-5(2)3-11-12(10)4-6(7,8)9/h3H,1,4,10H2,2H3/b11-3-.
What are the key properties of N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine?
N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine has a molecular weight of 181.16 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-amino-2,2,2-trifluoro-N-[(Z)-2-methylprop-2-enylideneamino]ethanamine is sourced from PubChem (CID 172941752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).