C6H12N2 — CID 129023174
1,1-bis(prop-1-en-2-yl)hydrazine (PubChem CID 129023174) has the molecular formula C6H12N2 and a molecular weight of 112.18 g/mol. Its IUPAC name is 1,1-bis(prop-1-en-2-yl)hydrazine.
| Compound Name | 1,1-bis(prop-1-en-2-yl)hydrazine |
|---|---|
| PubChem CID | 129023174 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1,1-bis(prop-1-en-2-yl)hydrazine |
| SMILES | C=C(C)N(N)C(=C)C |
| InChI | InChI=1S/C6H12N2/c1-5(2)8(7)6(3)4/h1,3,7H2,2,4H3 |
| InChIKey | UCNINPXCCSEQLH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|