C31H37F2N9O4 — CID 172942035
tert-butyl 4-[3-(3-ethyl-6-fluoroindazol-1-yl)-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate;3-ethyl-6-fluoro-N'-hydroxyindazole-1-carboximidamide (PubChem CID 172942035) has the molecular formula C31H37F2N9O4 and a molecular weight of 637.69 g/mol. Its IUPAC name is tert-butyl 4-[3-(3-ethyl-6-fluoroindazol-1-yl)-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate;3-ethyl-6-fluoro-N'-hydroxyindazole-1-carboximidamide.
| Compound Name | tert-butyl 4-[3-(3-ethyl-6-fluoroindazol-1-yl)-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate;3-ethyl-6-fluoro-N'-hydroxyindazole-1-carboximidamide |
|---|---|
| PubChem CID | 172942035 |
| Molecular Formula | C31H37F2N9O4 |
| Molecular Weight | 637.69 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | tert-butyl 4-[3-(3-ethyl-6-fluoroindazol-1-yl)-1,2,4-oxadiazol-5-yl]piperidine-1-carboxylate;3-ethyl-6-fluoro-N'-hydroxyindazole-1-carboximidamide |
| SMILES | CCc1nn(-c2noc(C3CCN(C(=O)OC(C)(C)C)CC3)n2)c2cc(F)ccc12.CCc1nn(/C(N)=N\O)c2cc(F)ccc12 |
| InChI | InChI=1S/C21H26FN5O3.C10H11FN4O/c1-5-16-15-7-6-14(22)12-17(15)27(24-16)19-23-18(30-25-19)13-8-10-26(11-9-13)20(28)29-21(2,3)4;1-2-8-7-4-3-6(11)5-9(7)15(13-8)10(12)14-16/h6-7,12-13H,5,8-11H2,1-4H3;3-5,16H,2H2,1H3,(H2,12,14) |
| InChIKey | CWEQGLOVVHQJST-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 162.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.69 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|