C16H18ClF3N2O3S — CID 172944200
CID 172944200 (PubChem CID 172944200) has the molecular formula C16H18ClF3N2O3S and a molecular weight of 410.85 g/mol.
| Compound Name | CID 172944200 |
|---|---|
| PubChem CID | 172944200 |
| Molecular Formula | C16H18ClF3N2O3S |
| Molecular Weight | 410.85 g/mol |
| Exact Mass | 410.07 |
| IUPAC Name | — |
| SMILES | CC/C(=N\OC1C=CCCC1)c1cc(Cl)ccc1C(F)(F)F.N=S(=O)=O |
| InChI | InChI=1S/C16H17ClF3NO.HNO2S/c1-2-15(21-22-12-6-4-3-5-7-12)13-10-11(17)8-9-14(13)16(18,19)20;1-4(2)3/h4,6,8-10,12H,2-3,5,7H2,1H3;1H/b21-15+; |
| InChIKey | HKTKYKQZHMMXHB-NEMIEIFKSA-N |
| XLogP | 5.23 |
| TPSA | 79.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.85 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|