C17H14ClF6N5S2 — CID 172944870
1,2-bis[(E)-[4-(trifluoromethylsulfanyl)phenyl]methylideneamino]guanidine;hydrochloride (PubChem CID 172944870) has the molecular formula C17H14ClF6N5S2 and a molecular weight of 501.91 g/mol. Its IUPAC name is 1,2-bis[(E)-[4-(trifluoromethylsulfanyl)phenyl]methylideneamino]guanidine;hydrochloride.
| Compound Name | 1,2-bis[(E)-[4-(trifluoromethylsulfanyl)phenyl]methylideneamino]guanidine;hydrochloride |
|---|---|
| PubChem CID | 172944870 |
| Molecular Formula | C17H14ClF6N5S2 |
| Molecular Weight | 501.91 g/mol |
| Exact Mass | 501.03 |
| IUPAC Name | 1,2-bis[(E)-[4-(trifluoromethylsulfanyl)phenyl]methylideneamino]guanidine;hydrochloride |
| SMILES | Cl.NC(=N/N=C/c1ccc(SC(F)(F)F)cc1)N/N=C/c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13F6N5S2.ClH/c18-16(19,20)29-13-5-1-11(2-6-13)9-25-27-15(24)28-26-10-12-3-7-14(8-4-12)30-17(21,22)23;/h1-10H,(H3,24,27,28);1H/b25-9+,26-10+; |
| InChIKey | BVKSLHRXEBGONH-MSGQZJGISA-N |
| XLogP | 5.60 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.91 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|