C32H34N4O5 — CID 172953941
2-hydroxy-3-methylbenzohydrazide;2-hydroxy-3-methyl-N-[(E)-1-phenylethylideneamino]benzamide;1-phenylethanone (PubChem CID 172953941) has the molecular formula C32H34N4O5 and a molecular weight of 554.65 g/mol. Its IUPAC name is 2-hydroxy-3-methylbenzohydrazide;2-hydroxy-3-methyl-N-[(E)-1-phenylethylideneamino]benzamide;1-phenylethanone.
| Compound Name | 2-hydroxy-3-methylbenzohydrazide;2-hydroxy-3-methyl-N-[(E)-1-phenylethylideneamino]benzamide;1-phenylethanone |
|---|---|
| PubChem CID | 172953941 |
| Molecular Formula | C32H34N4O5 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 2-hydroxy-3-methylbenzohydrazide;2-hydroxy-3-methyl-N-[(E)-1-phenylethylideneamino]benzamide;1-phenylethanone |
| SMILES | C/C(=N\NC(=O)c1cccc(C)c1O)c1ccccc1.CC(=O)c1ccccc1.Cc1cccc(C(=O)NN)c1O |
| InChI | InChI=1S/C16H16N2O2.C8H10N2O2.C8H8O/c1-11-7-6-10-14(15(11)19)16(20)18-17-12(2)13-8-4-3-5-9-13;1-5-3-2-4-6(7(5)11)8(12)10-9;1-7(9)8-5-3-2-4-6-8/h3-10,19H,1-2H3,(H,18,20);2-4,11H,9H2,1H3,(H,10,12);2-6H,1H3/b17-12+;; |
| InChIKey | PHIKVWUEISDJFR-CWQUOYFRSA-N |
| XLogP | 5.05 |
| TPSA | 154.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|