C25H50N4 — CID 172953973
2-N,4-N-bis(propan-2-ylideneamino)pentane-2,4-diimine;7-methyltridecane (PubChem CID 172953973) has the molecular formula C25H50N4 and a molecular weight of 406.70 g/mol. Its IUPAC name is 2-N,4-N-bis(propan-2-ylideneamino)pentane-2,4-diimine;7-methyltridecane.
| Compound Name | 2-N,4-N-bis(propan-2-ylideneamino)pentane-2,4-diimine;7-methyltridecane |
|---|---|
| PubChem CID | 172953973 |
| Molecular Formula | C25H50N4 |
| Molecular Weight | 406.70 g/mol |
| Exact Mass | 406.40 |
| IUPAC Name | 2-N,4-N-bis(propan-2-ylideneamino)pentane-2,4-diimine;7-methyltridecane |
| SMILES | CC(C)=N/N=C(/C)C/C(C)=N\N=C(C)C.CCCCCCC(C)CCCCCC |
| InChI | InChI=1S/C14H30.C11H20N4/c1-4-6-8-10-12-14(3)13-11-9-7-5-2;1-8(2)12-14-10(5)7-11(6)15-13-9(3)4/h14H,4-13H2,1-3H3;7H2,1-6H3/b;14-10-,15-11- |
| InChIKey | PHTHHZOZGINIBN-GTBDSMFASA-N |
| XLogP | 8.65 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.70 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|