C18H34N4 — CID 134882121
3,8-didiazo-2,2,4,4,7,7,9,9-octamethyldecane (PubChem CID 134882121) has the molecular formula C18H34N4 and a molecular weight of 306.50 g/mol. Its IUPAC name is 3,8-didiazo-2,2,4,4,7,7,9,9-octamethyldecane.
| Compound Name | 3,8-didiazo-2,2,4,4,7,7,9,9-octamethyldecane |
|---|---|
| PubChem CID | 134882121 |
| Molecular Formula | C18H34N4 |
| Molecular Weight | 306.50 g/mol |
| Exact Mass | 306.28 |
| IUPAC Name | 3,8-didiazo-2,2,4,4,7,7,9,9-octamethyldecane |
| SMILES | CC(C)(C)C(=[N+]=[N-])C(C)(C)CCC(C)(C)C(=[N+]=[N-])C(C)(C)C |
| InChI | InChI=1S/C18H34N4/c1-15(2,3)13(21-19)17(7,8)11-12-18(9,10)14(22-20)16(4,5)6/h11-12H2,1-10H3 |
| InChIKey | DBLJQSLIKFBSFC-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 72.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.50 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|