C18H38N4 — CID 10519046
(E)-[(1E,6E)-1-tert-butyl-1,6-dihydrazinylidene-2,2,5,5,7,7-hexamethyloctylidene]hydrazine (PubChem CID 10519046) has the molecular formula C18H38N4 and a molecular weight of 310.53 g/mol. Its IUPAC name is (E)-[(1E,6E)-1-tert-butyl-1,6-dihydrazinylidene-2,2,5,5,7,7-hexamethyloctylidene]hydrazine.
| Compound Name | (E)-[(1E,6E)-1-tert-butyl-1,6-dihydrazinylidene-2,2,5,5,7,7-hexamethyloctylidene]hydrazine |
|---|---|
| PubChem CID | 10519046 |
| Molecular Formula | C18H38N4 |
| Molecular Weight | 310.53 g/mol |
| Exact Mass | 310.31 |
| IUPAC Name | (E)-[(1E,6E)-1-tert-butyl-1,6-dihydrazinylidene-2,2,5,5,7,7-hexamethyloctylidene]hydrazine |
| SMILES | CC(C)(C)/C(=N\N)C(C)(C)CCC(C)(C)/C(=N/N)C(C)(C)C |
| InChI | InChI=1S/C18H38N4/c1-15(2,3)13(21-19)17(7,8)11-12-18(9,10)14(22-20)16(4,5)6/h11-12,19-20H2,1-10H3/b21-13+,22-14+ |
| InChIKey | JOTLOCDQRCEOOK-JFMUQQRKSA-N |
| XLogP | 4.54 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|