C11H22N4 — CID 843872
(7-hydrazinylidene-2,2,6,6-tetramethylcycloheptylidene)hydrazine (PubChem CID 843872) has the molecular formula C11H22N4 and a molecular weight of 210.32 g/mol. Its IUPAC name is (7-hydrazinylidene-2,2,6,6-tetramethylcycloheptylidene)hydrazine.
| Compound Name | (7-hydrazinylidene-2,2,6,6-tetramethylcycloheptylidene)hydrazine |
|---|---|
| PubChem CID | 843872 |
| Molecular Formula | C11H22N4 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.18 |
| IUPAC Name | (7-hydrazinylidene-2,2,6,6-tetramethylcycloheptylidene)hydrazine |
| SMILES | CC1(C)CCCC(C)(C)C(=NN)C1=NN |
| InChI | InChI=1S/C11H22N4/c1-10(2)6-5-7-11(3,4)9(15-13)8(10)14-12/h5-7,12-13H2,1-4H3 |
| InChIKey | LMEUCBIDGSMGLJ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|