C14H28N2 — CID 178040911
ethane;3,3,5,5,7-pentamethylcycloheptane-1,2-diimine (PubChem CID 178040911) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is ethane;3,3,5,5,7-pentamethylcycloheptane-1,2-diimine.
| Compound Name | ethane;3,3,5,5,7-pentamethylcycloheptane-1,2-diimine |
|---|---|
| PubChem CID | 178040911 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | ethane;3,3,5,5,7-pentamethylcycloheptane-1,2-diimine |
| SMILES | CC.[H]/N=C1C(=N\[H])\C(C)CC(C)(C)CC\1(C)C |
| InChI | InChI=1S/C12H22N2.C2H6/c1-8-6-11(2,3)7-12(4,5)10(14)9(8)13;1-2/h8,13-14H,6-7H2,1-5H3;1-2H3/b13-9+,14-10+; |
| InChIKey | IXOHNUGSXFXUEB-ALGRVRKVSA-N |
| XLogP | 4.53 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|