C14H28N4 — CID 134897028
(Z)-[(2Z)-2-hydrazinylidene-5,5,8,8-tetramethylcyclodecylidene]hydrazine (PubChem CID 134897028) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is (Z)-[(2Z)-2-hydrazinylidene-5,5,8,8-tetramethylcyclodecylidene]hydrazine.
| Compound Name | (Z)-[(2Z)-2-hydrazinylidene-5,5,8,8-tetramethylcyclodecylidene]hydrazine |
|---|---|
| PubChem CID | 134897028 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | (Z)-[(2Z)-2-hydrazinylidene-5,5,8,8-tetramethylcyclodecylidene]hydrazine |
| SMILES | CC1(C)CCC(=N/N)/C(=N\N)CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H28N4/c1-13(2)7-5-11(17-15)12(18-16)6-8-14(3,4)10-9-13/h5-10,15-16H2,1-4H3/b17-11-,18-12- |
| InChIKey | LAMNDIZQMLCWFS-WHYMJUELSA-N |
| XLogP | 3.02 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|