C12H24N4 — CID 134897029
(Z)-[(2Z)-2-hydrazinylidene-4,4,7,7-tetramethylcyclooctylidene]hydrazine (PubChem CID 134897029) has the molecular formula C12H24N4 and a molecular weight of 224.35 g/mol. Its IUPAC name is (Z)-[(2Z)-2-hydrazinylidene-4,4,7,7-tetramethylcyclooctylidene]hydrazine.
| Compound Name | (Z)-[(2Z)-2-hydrazinylidene-4,4,7,7-tetramethylcyclooctylidene]hydrazine |
|---|---|
| PubChem CID | 134897029 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | (Z)-[(2Z)-2-hydrazinylidene-4,4,7,7-tetramethylcyclooctylidene]hydrazine |
| SMILES | CC1(C)CCC(C)(C)CC(=N/N)/C(=N\N)C1 |
| InChI | InChI=1S/C12H24N4/c1-11(2)5-6-12(3,4)8-10(16-14)9(7-11)15-13/h5-8,13-14H2,1-4H3/b15-9-,16-10- |
| InChIKey | DMHREEATVRETAQ-VULZFCBJSA-N |
| XLogP | 2.24 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|