C18H36N2 — CID 10779161
2,2,4,4,7,7,9,9-octamethyldecane-3,8-diimine (PubChem CID 10779161) has the molecular formula C18H36N2 and a molecular weight of 280.50 g/mol. Its IUPAC name is 2,2,4,4,7,7,9,9-octamethyldecane-3,8-diimine.
| Compound Name | 2,2,4,4,7,7,9,9-octamethyldecane-3,8-diimine |
|---|---|
| PubChem CID | 10779161 |
| Molecular Formula | C18H36N2 |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.29 |
| IUPAC Name | 2,2,4,4,7,7,9,9-octamethyldecane-3,8-diimine |
| SMILES | [H]/N=C(\C(C)(C)C)C(C)(C)CCC(C)(C)/C(=N/[H])C(C)(C)C |
| InChI | InChI=1S/C18H36N2/c1-15(2,3)13(19)17(7,8)11-12-18(9,10)14(20)16(4,5)6/h19-20H,11-12H2,1-10H3/b19-13+,20-14+ |
| InChIKey | KOVUMBXQOVELLD-IWGRKNQJSA-N |
| XLogP | 5.95 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|