C16H32N2 — CID 123347074
2,4,4,6,6,9-hexamethyldecane-3,8-diimine (PubChem CID 123347074) has the molecular formula C16H32N2 and a molecular weight of 252.45 g/mol. Its IUPAC name is 2,4,4,6,6,9-hexamethyldecane-3,8-diimine.
| Compound Name | 2,4,4,6,6,9-hexamethyldecane-3,8-diimine |
|---|---|
| PubChem CID | 123347074 |
| Molecular Formula | C16H32N2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.26 |
| IUPAC Name | 2,4,4,6,6,9-hexamethyldecane-3,8-diimine |
| SMILES | [H]/N=C(/CC(C)(C)CC(C)(C)/C(=N/[H])C(C)C)C(C)C |
| InChI | InChI=1S/C16H32N2/c1-11(2)13(17)9-15(5,6)10-16(7,8)14(18)12(3)4/h11-12,17-18H,9-10H2,1-8H3/b17-13-,18-14+ |
| InChIKey | JFJFVWBHMPZCEV-SIJTWYJSSA-N |
| XLogP | 5.17 |
| TPSA | 47.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|