C17H36N2 — CID 54293067
8-ethyl-6-imino-3,5,5-trimethyldodecan-1-amine (PubChem CID 54293067) has the molecular formula C17H36N2 and a molecular weight of 268.49 g/mol. Its IUPAC name is 8-ethyl-6-imino-3,5,5-trimethyldodecan-1-amine.
| Compound Name | 8-ethyl-6-imino-3,5,5-trimethyldodecan-1-amine |
|---|---|
| PubChem CID | 54293067 |
| Molecular Formula | C17H36N2 |
| Molecular Weight | 268.49 g/mol |
| Exact Mass | 268.29 |
| IUPAC Name | 8-ethyl-6-imino-3,5,5-trimethyldodecan-1-amine |
| SMILES | [H]/N=C(\CC(CC)CCCC)C(C)(C)CC(C)CCN |
| InChI | InChI=1S/C17H36N2/c1-6-8-9-15(7-2)12-16(19)17(4,5)13-14(3)10-11-18/h14-15,19H,6-13,18H2,1-5H3/b19-16+ |
| InChIKey | RYWKJTWKEBUNIU-KNTRCKAVSA-N |
| XLogP | 5.01 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|