C24H31BrN2O — CID 172956096
3-bromoprop-1-ene;N-methyl-N-[(E)-1-phenylethylideneamino]methanamine;1-phenylpent-4-en-1-one (PubChem CID 172956096) has the molecular formula C24H31BrN2O and a molecular weight of 443.43 g/mol. Its IUPAC name is 3-bromoprop-1-ene;N-methyl-N-[(E)-1-phenylethylideneamino]methanamine;1-phenylpent-4-en-1-one.
| Compound Name | 3-bromoprop-1-ene;N-methyl-N-[(E)-1-phenylethylideneamino]methanamine;1-phenylpent-4-en-1-one |
|---|---|
| PubChem CID | 172956096 |
| Molecular Formula | C24H31BrN2O |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 3-bromoprop-1-ene;N-methyl-N-[(E)-1-phenylethylideneamino]methanamine;1-phenylpent-4-en-1-one |
| SMILES | C/C(=N\N(C)C)c1ccccc1.C=CCBr.C=CCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C11H12O.C10H14N2.C3H5Br/c1-2-3-9-11(12)10-7-5-4-6-8-10;1-9(11-12(2)3)10-7-5-4-6-8-10;1-2-3-4/h2,4-8H,1,3,9H2;4-8H,1-3H3;2H,1,3H2/b;11-9+; |
| InChIKey | JANWSDFKESUGCR-XHNJQLCBSA-N |
| XLogP | 6.38 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|