C14H14N2O5S — CID 172958474
N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]benzenesulfonamide (PubChem CID 172958474) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]benzenesulfonamide.
| Compound Name | N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 172958474 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | N-[(E)-1-(6-methyl-2,4-dioxopyran-3-yl)ethylideneamino]benzenesulfonamide |
| SMILES | CC1=CC(=O)C(/C(C)=N/NS(=O)(=O)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C14H14N2O5S/c1-9-8-12(17)13(14(18)21-9)10(2)15-16-22(19,20)11-6-4-3-5-7-11/h3-8,13,16H,1-2H3/b15-10+ |
| InChIKey | RWSZWWYVCVSBAZ-XNTDXEJSSA-N |
| XLogP | 0.99 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|