C14H14N2O5S — CID 822535
4-[1-[(3R)-6-methyl-2,4-dioxopyran-3-yl]ethylideneamino]benzenesulfonamide (PubChem CID 822535) has the molecular formula C14H14N2O5S and a molecular weight of 322.34 g/mol. Its IUPAC name is 4-[1-[(3R)-6-methyl-2,4-dioxopyran-3-yl]ethylideneamino]benzenesulfonamide.
| Compound Name | 4-[1-[(3R)-6-methyl-2,4-dioxopyran-3-yl]ethylideneamino]benzenesulfonamide |
|---|---|
| PubChem CID | 822535 |
| Molecular Formula | C14H14N2O5S |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.06 |
| IUPAC Name | 4-[1-[(3R)-6-methyl-2,4-dioxopyran-3-yl]ethylideneamino]benzenesulfonamide |
| SMILES | CC1=CC(=O)[C@@H](/C(C)=N/c2ccc(S(N)(=O)=O)cc2)C(=O)O1 |
| InChI | InChI=1S/C14H14N2O5S/c1-8-7-12(17)13(14(18)21-8)9(2)16-10-3-5-11(6-4-10)22(15,19)20/h3-7,13H,1-2H3,(H2,15,19,20)/b16-9+/t13-/m1/s1 |
| InChIKey | RVYKCICDZXWWMA-BPKVKKHESA-N |
| XLogP | 1.07 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|