C30H27N7O4S — CID 172959054
N-[(E)-1-[5-[[1-[(4-methoxyphenyl)methyl]pyrazolo[4,3-b]pyridin-3-yl]amino]-1,2-benzoxazol-3-yl]ethylideneamino]-4-methylbenzenesulfonamide (PubChem CID 172959054) has the molecular formula C30H27N7O4S and a molecular weight of 581.66 g/mol. Its IUPAC name is N-[(E)-1-[5-[[1-[(4-methoxyphenyl)methyl]pyrazolo[4,3-b]pyridin-3-yl]amino]-1,2-benzoxazol-3-yl]ethylideneamino]-4-methylbenzenesulfonamide.
| Compound Name | N-[(E)-1-[5-[[1-[(4-methoxyphenyl)methyl]pyrazolo[4,3-b]pyridin-3-yl]amino]-1,2-benzoxazol-3-yl]ethylideneamino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 172959054 |
| Molecular Formula | C30H27N7O4S |
| Molecular Weight | 581.66 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | N-[(E)-1-[5-[[1-[(4-methoxyphenyl)methyl]pyrazolo[4,3-b]pyridin-3-yl]amino]-1,2-benzoxazol-3-yl]ethylideneamino]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(Cn2nc(Nc3ccc4onc(/C(C)=N/NS(=O)(=O)c5ccc(C)cc5)c4c3)c3ncccc32)cc1 |
| InChI | InChI=1S/C30H27N7O4S/c1-19-6-13-24(14-7-19)42(38,39)36-33-20(2)28-25-17-22(10-15-27(25)41-35-28)32-30-29-26(5-4-16-31-29)37(34-30)18-21-8-11-23(40-3)12-9-21/h4-17,36H,18H2,1-3H3,(H,32,34)/b33-20+ |
| InChIKey | YRJCKIOQXUSXQH-FMFFXOCNSA-N |
| XLogP | 5.38 |
| TPSA | 136.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|