C26H30ClN3O4 — CID 172959408
(2Z)-2-[2-[[3-chloro-5-(1-phenylmethoxyethyl)-2-pyridinyl]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide;methane (PubChem CID 172959408) has the molecular formula C26H30ClN3O4 and a molecular weight of 484.00 g/mol. Its IUPAC name is (2Z)-2-[2-[[3-chloro-5-(1-phenylmethoxyethyl)-2-pyridinyl]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide;methane.
| Compound Name | (2Z)-2-[2-[[3-chloro-5-(1-phenylmethoxyethyl)-2-pyridinyl]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide;methane |
|---|---|
| PubChem CID | 172959408 |
| Molecular Formula | C26H30ClN3O4 |
| Molecular Weight | 484.00 g/mol |
| Exact Mass | 483.19 |
| IUPAC Name | (2Z)-2-[2-[[3-chloro-5-(1-phenylmethoxyethyl)-2-pyridinyl]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide;methane |
| SMILES | C.CNC(=O)/C(=N\OC)c1ccccc1COc1ncc(C(C)OCc2ccccc2)cc1Cl |
| InChI | InChI=1S/C25H26ClN3O4.CH4/c1-17(32-15-18-9-5-4-6-10-18)20-13-22(26)25(28-14-20)33-16-19-11-7-8-12-21(19)23(29-31-3)24(30)27-2;/h4-14,17H,15-16H2,1-3H3,(H,27,30);1H4/b29-23-; |
| InChIKey | XXQCMEGHPMHEAL-MBANDDHJSA-N |
| XLogP | 5.32 |
| TPSA | 82.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.00 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|