C20H17Cl3N4O3 — CID 141334972
2-[2-[[4-chloro-1-(2,4-dichlorophenyl)pyrazol-3-yl]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 141334972) has the molecular formula C20H17Cl3N4O3 and a molecular weight of 467.74 g/mol. Its IUPAC name is 2-[2-[[4-chloro-1-(2,4-dichlorophenyl)pyrazol-3-yl]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | 2-[2-[[4-chloro-1-(2,4-dichlorophenyl)pyrazol-3-yl]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 141334972 |
| Molecular Formula | C20H17Cl3N4O3 |
| Molecular Weight | 467.74 g/mol |
| Exact Mass | 466.04 |
| IUPAC Name | 2-[2-[[4-chloro-1-(2,4-dichlorophenyl)pyrazol-3-yl]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)C(=NOC)c1ccccc1COc1nn(-c2ccc(Cl)cc2Cl)cc1Cl |
| InChI | InChI=1S/C20H17Cl3N4O3/c1-24-19(28)18(26-29-2)14-6-4-3-5-12(14)11-30-20-16(23)10-27(25-20)17-8-7-13(21)9-15(17)22/h3-10H,11H2,1-2H3,(H,24,28) |
| InChIKey | BUJIHSULADOTTB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.74 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|