C21H20ClF3N4O4 — CID 172951024
(2E)-2-[2-[[4-chloro-1-[3-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]pyrazol-3-yl]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide (PubChem CID 172951024) has the molecular formula C21H20ClF3N4O4 and a molecular weight of 484.86 g/mol. Its IUPAC name is (2E)-2-[2-[[4-chloro-1-[3-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]pyrazol-3-yl]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide.
| Compound Name | (2E)-2-[2-[[4-chloro-1-[3-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]pyrazol-3-yl]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
|---|---|
| PubChem CID | 172951024 |
| Molecular Formula | C21H20ClF3N4O4 |
| Molecular Weight | 484.86 g/mol |
| Exact Mass | 484.11 |
| IUPAC Name | (2E)-2-[2-[[4-chloro-1-[3-(trifluoromethoxy)cyclohexa-2,4-dien-1-yl]pyrazol-3-yl]oxymethyl]phenyl]-2-methoxyimino-N-methylacetamide |
| SMILES | CNC(=O)/C(=N/OC)c1ccccc1COc1nn(C2C=C(OC(F)(F)F)C=CC2)cc1Cl |
| InChI | InChI=1S/C21H20ClF3N4O4/c1-26-19(30)18(28-31-2)16-9-4-3-6-13(16)12-32-20-17(22)11-29(27-20)14-7-5-8-15(10-14)33-21(23,24)25/h3-6,8-11,14H,7,12H2,1-2H3,(H,26,30)/b28-18+ |
| InChIKey | QRWDVGOSCMWUNS-MTDXEUNCSA-N |
| XLogP | 4.13 |
| TPSA | 86.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.86 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|