C13H13BN2O2S2 — CID 172965706
CID 172965706 (PubChem CID 172965706) has the molecular formula C13H13BN2O2S2 and a molecular weight of 304.21 g/mol.
| Compound Name | CID 172965706 |
|---|---|
| PubChem CID | 172965706 |
| Molecular Formula | C13H13BN2O2S2 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | — |
| SMILES | [B]c1ccsc1/C(C)=N/NS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H13BN2O2S2/c1-9-3-5-11(6-4-9)20(17,18)16-15-10(2)13-12(14)7-8-19-13/h3-8,16H,1-2H3/b15-10+ |
| InChIKey | NSGSYARWSIIIGQ-XNTDXEJSSA-N |
| XLogP | 1.55 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|