C28H37N3O6P3S+ — CID 172967184
[4-[[benzyl(dimethoxyphosphanylmethyl)amino]-dimethoxyphosphanylmethyl]phenoxy]-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium (PubChem CID 172967184) has the molecular formula C28H37N3O6P3S+ and a molecular weight of 636.61 g/mol. Its IUPAC name is [4-[[benzyl(dimethoxyphosphanylmethyl)amino]-dimethoxyphosphanylmethyl]phenoxy]-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium.
| Compound Name | [4-[[benzyl(dimethoxyphosphanylmethyl)amino]-dimethoxyphosphanylmethyl]phenoxy]-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 172967184 |
| Molecular Formula | C28H37N3O6P3S+ |
| Molecular Weight | 636.61 g/mol |
| Exact Mass | 636.16 |
| IUPAC Name | [4-[[benzyl(dimethoxyphosphanylmethyl)amino]-dimethoxyphosphanylmethyl]phenoxy]-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium |
| SMILES | COc1ccc(/C=N/N(C)[P+](=S)Oc2ccc(C(N(Cc3ccccc3)CP(OC)OC)P(OC)OC)cc2)cc1 |
| InChI | InChI=1S/C28H37N3O6P3S/c1-30(29-20-23-12-16-26(32-2)17-13-23)40(41)37-27-18-14-25(15-19-27)28(39(35-5)36-6)31(22-38(33-3)34-4)21-24-10-8-7-9-11-24/h7-20,28H,21-22H2,1-6H3/q+1/b29-20+ |
| InChIKey | IJGIXDOUCRZOBJ-ZTKZIYFRSA-N |
| XLogP | 7.48 |
| TPSA | 74.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.61 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|