C26H46N3O5P2SSi3+ — CID 91401996
[4-[bis(trimethylsilyloxy)phosphoryl-[methyl(trimethylsilyl)amino]methyl]phenoxy]-[[(Z)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium (PubChem CID 91401996) has the molecular formula C26H46N3O5P2SSi3+ and a molecular weight of 658.94 g/mol. Its IUPAC name is [4-[bis(trimethylsilyloxy)phosphoryl-[methyl(trimethylsilyl)amino]methyl]phenoxy]-[[(Z)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium.
| Compound Name | [4-[bis(trimethylsilyloxy)phosphoryl-[methyl(trimethylsilyl)amino]methyl]phenoxy]-[[(Z)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 91401996 |
| Molecular Formula | C26H46N3O5P2SSi3+ |
| Molecular Weight | 658.94 g/mol |
| Exact Mass | 658.19 |
| IUPAC Name | [4-[bis(trimethylsilyloxy)phosphoryl-[methyl(trimethylsilyl)amino]methyl]phenoxy]-[[(Z)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium |
| SMILES | COc1ccc(/C=N\N(C)[P+](=S)Oc2ccc(C(N(C)[Si](C)(C)C)P(=O)(O[Si](C)(C)C)O[Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H46N3O5P2SSi3/c1-28(38(4,5)6)26(36(30,33-39(7,8)9)34-40(10,11)12)23-15-19-25(20-16-23)32-35(37)29(2)27-21-22-13-17-24(31-3)18-14-22/h13-21,26H,1-12H3/q+1/b27-21- |
| InChIKey | ISGHCLKETYLACC-MEFGMAGPSA-N |
| XLogP | 8.48 |
| TPSA | 72.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.94 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|