C23H35N3O8P3S+ — CID 59558263
[4-[2-[bis(dimethoxyphosphorylmethyl)amino]ethyl]phenoxy]-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium (PubChem CID 59558263) has the molecular formula C23H35N3O8P3S+ and a molecular weight of 606.54 g/mol. Its IUPAC name is [4-[2-[bis(dimethoxyphosphorylmethyl)amino]ethyl]phenoxy]-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium.
| Compound Name | [4-[2-[bis(dimethoxyphosphorylmethyl)amino]ethyl]phenoxy]-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 59558263 |
| Molecular Formula | C23H35N3O8P3S+ |
| Molecular Weight | 606.54 g/mol |
| Exact Mass | 606.14 |
| IUPAC Name | [4-[2-[bis(dimethoxyphosphorylmethyl)amino]ethyl]phenoxy]-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium |
| SMILES | COc1ccc(/C=N/N(C)[P+](=S)Oc2ccc(CCN(CP(=O)(OC)OC)CP(=O)(OC)OC)cc2)cc1 |
| InChI | InChI=1S/C23H35N3O8P3S/c1-25(24-17-21-9-11-22(29-2)12-10-21)35(38)34-23-13-7-20(8-14-23)15-16-26(18-36(27,30-3)31-4)19-37(28,32-5)33-6/h7-14,17H,15-16,18-19H2,1-6H3/q+1/b24-17+ |
| InChIKey | VNFGWPNLUJRTCU-JJIBRWJFSA-N |
| XLogP | 5.55 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.54 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|