C24H35N3O8P3S+ — CID 58875582
[4-[dimethoxyphosphoryl-[dimethoxyphosphorylmethyl(prop-2-enyl)amino]methyl]phenoxy]-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium (PubChem CID 58875582) has the molecular formula C24H35N3O8P3S+ and a molecular weight of 618.55 g/mol. Its IUPAC name is [4-[dimethoxyphosphoryl-[dimethoxyphosphorylmethyl(prop-2-enyl)amino]methyl]phenoxy]-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium.
| Compound Name | [4-[dimethoxyphosphoryl-[dimethoxyphosphorylmethyl(prop-2-enyl)amino]methyl]phenoxy]-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium |
|---|---|
| PubChem CID | 58875582 |
| Molecular Formula | C24H35N3O8P3S+ |
| Molecular Weight | 618.55 g/mol |
| Exact Mass | 618.14 |
| IUPAC Name | [4-[dimethoxyphosphoryl-[dimethoxyphosphorylmethyl(prop-2-enyl)amino]methyl]phenoxy]-[[(E)-(4-methoxyphenyl)methylideneamino]-methylamino]-sulfanylidenephosphanium |
| SMILES | C=CCN(CP(=O)(OC)OC)C(c1ccc(O[P+](=S)N(C)/N=C/c2ccc(OC)cc2)cc1)P(=O)(OC)OC |
| InChI | InChI=1S/C24H35N3O8P3S/c1-8-17-27(19-37(28,31-4)32-5)24(38(29,33-6)34-7)21-11-15-23(16-12-21)35-36(39)26(2)25-18-20-9-13-22(30-3)14-10-20/h8-16,18,24H,1,17,19H2,2-7H3/q+1/b25-18+ |
| InChIKey | OMHGYUHANPJGEV-XIEYBQDHSA-N |
| XLogP | 6.23 |
| TPSA | 108.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.55 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|