About N-benzyl-N-hexylnitrous amide
N-benzyl-N-hexylnitrous amide (PubChem CID 172967726) has the molecular formula C13H20N2O
and a molecular weight of 220.32 g/mol. Its IUPAC name is N-benzyl-N-hexylnitrous amide.
Molecular Properties
| Compound Name | N-benzyl-N-hexylnitrous amide |
| PubChem CID | 172967726 |
| Molecular Formula | C13H20N2O |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.16 |
| IUPAC Name | N-benzyl-N-hexylnitrous amide |
| SMILES | CCCCCCN(Cc1ccccc1)N=O |
| InChI | InChI=1S/C13H20N2O/c1-2-3-4-8-11-15(14-16)12-13-9-6-5-7-10-13/h5-7,9-10H,2-4,8,11-12H2,1H3 |
| InChIKey | LNURUVBBFGXKHP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-N-hexylnitrous amide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-hexylnitrous amide?
The IUPAC name of N-benzyl-N-hexylnitrous amide (CID 172967726) is N-benzyl-N-hexylnitrous amide.
What is the SMILES notation for N-benzyl-N-hexylnitrous amide?
The canonical SMILES for N-benzyl-N-hexylnitrous amide is CCCCCCN(Cc1ccccc1)N=O.
What is the InChIKey of N-benzyl-N-hexylnitrous amide?
The InChIKey is LNURUVBBFGXKHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O/c1-2-3-4-8-11-15(14-16)12-13-9-6-5-7-10-13/h5-7,9-10H,2-4,8,11-12H2,1H3.
What are the key properties of N-benzyl-N-hexylnitrous amide?
N-benzyl-N-hexylnitrous amide has a molecular weight of 220.32 g/mol, XLogP of 3.75, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-hexylnitrous amide is sourced from PubChem (CID 172967726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).