C20H24FN3O — CID 172968241
3-[1-[[(1S,2S,4S)-2-fluoro-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one (PubChem CID 172968241) has the molecular formula C20H24FN3O and a molecular weight of 341.43 g/mol. Its IUPAC name is 3-[1-[[(1S,2S,4S)-2-fluoro-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one.
| Compound Name | 3-[1-[[(1S,2S,4S)-2-fluoro-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 172968241 |
| Molecular Formula | C20H24FN3O |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 3-[1-[[(1S,2S,4S)-2-fluoro-2-bicyclo[2.2.1]hept-5-enyl]methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1C1CCN(C[C@]2(F)C[C@H]3C=C[C@@H]2C3)CC1 |
| InChI | InChI=1S/C20H24FN3O/c21-20(12-14-5-6-15(20)11-14)13-23-9-7-16(8-10-23)24-18-4-2-1-3-17(18)22-19(24)25/h1-6,14-16H,7-13H2,(H,22,25)/t14-,15+,20+/m0/s1 |
| InChIKey | UZQRNLYXSABYLP-BXTJHSDWSA-N |
| XLogP | 3.27 |
| TPSA | 41.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|